C27H45N — CID 70430032
(2S,7S)-7-ethyl-2-hexyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydro-1H-chrysene-2-carbonitrile (PubChem CID 70430032) has the molecular formula C27H45N and a molecular weight of 383.66 g/mol. Its IUPAC name is (2S,7S)-7-ethyl-2-hexyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydro-1H-chrysene-2-carbonitrile.
| Compound Name | (2S,7S)-7-ethyl-2-hexyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydro-1H-chrysene-2-carbonitrile |
|---|---|
| PubChem CID | 70430032 |
| Molecular Formula | C27H45N |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 383.36 |
| IUPAC Name | (2S,7S)-7-ethyl-2-hexyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydro-1H-chrysene-2-carbonitrile |
| SMILES | CCCCCC[C@]1(C#N)CCC2C(CCC3C2CCC2C3CCC[C@@H]2CC)C1 |
| InChI | InChI=1S/C27H45N/c1-3-5-6-7-16-27(19-28)17-15-23-21(18-27)11-12-26-24-10-8-9-20(4-2)22(24)13-14-25(23)26/h20-26H,3-18H2,1-2H3/t20-,21?,22?,23?,24?,25?,26?,27-/m0/s1 |
| InChIKey | LLSVAHHXWBJABM-RBSOZFCYSA-N |
| XLogP | 8.15 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|