C31H53N — CID 70430020
(2S,7S)-2-heptyl-7-pentyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydro-1H-chrysene-2-carbonitrile (PubChem CID 70430020) has the molecular formula C31H53N and a molecular weight of 439.77 g/mol. Its IUPAC name is (2S,7S)-2-heptyl-7-pentyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydro-1H-chrysene-2-carbonitrile.
| Compound Name | (2S,7S)-2-heptyl-7-pentyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydro-1H-chrysene-2-carbonitrile |
|---|---|
| PubChem CID | 70430020 |
| Molecular Formula | C31H53N |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 439.42 |
| IUPAC Name | (2S,7S)-2-heptyl-7-pentyl-3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-hexadecahydro-1H-chrysene-2-carbonitrile |
| SMILES | CCCCCCC[C@]1(C#N)CCC2C(CCC3C2CCC2C3CCC[C@@H]2CCCCC)C1 |
| InChI | InChI=1S/C31H53N/c1-3-5-7-8-10-20-31(23-32)21-19-27-25(22-31)15-16-30-28-14-11-13-24(12-9-6-4-2)26(28)17-18-29(27)30/h24-30H,3-22H2,1-2H3/t24-,25?,26?,27?,28?,29?,30?,31-/m0/s1 |
| InChIKey | YEADFECCDQWAFN-HUAZAISHSA-N |
| XLogP | 9.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|