C16H27N — CID 70454015
(1R,2S,6S)-6-butyl-1-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonitrile (PubChem CID 70454015) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is (1R,2S,6S)-6-butyl-1-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonitrile.
| Compound Name | (1R,2S,6S)-6-butyl-1-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 70454015 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (1R,2S,6S)-6-butyl-1-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonitrile |
| SMILES | CCCC[C@H]1CCC2C(CC[C@H](C#N)[C@@H]2C)C1 |
| InChI | InChI=1S/C16H27N/c1-3-4-5-13-6-9-16-12(2)15(11-17)8-7-14(16)10-13/h12-16H,3-10H2,1-2H3/t12-,13-,14?,15+,16?/m0/s1 |
| InChIKey | IMWOJZZZWHBHLY-NEIABLLTSA-N |
| XLogP | 4.78 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |