C16H30 — CID 140848336
1-methyl-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 140848336) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 1-methyl-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 1-methyl-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 140848336 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 1-methyl-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCC1CCC2C(C)CCCC2C1 |
| InChI | InChI=1S/C16H30/c1-3-4-5-8-14-10-11-16-13(2)7-6-9-15(16)12-14/h13-16H,3-12H2,1-2H3 |
| InChIKey | OOFGCHMXUSBRGD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|