C21H38O — CID 70506704
(2S,7S)-2-ethyl-7-pentoxy-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene (PubChem CID 70506704) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is (2S,7S)-2-ethyl-7-pentoxy-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene.
| Compound Name | (2S,7S)-2-ethyl-7-pentoxy-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
|---|---|
| PubChem CID | 70506704 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | (2S,7S)-2-ethyl-7-pentoxy-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
| SMILES | CCCCCO[C@H]1CCC2C(CCC3C[C@@H](CC)CCC32)C1 |
| InChI | InChI=1S/C21H38O/c1-3-5-6-13-22-19-10-12-21-18(15-19)9-8-17-14-16(4-2)7-11-20(17)21/h16-21H,3-15H2,1-2H3/t16-,17?,18?,19-,20?,21?/m0/s1 |
| InChIKey | QRTPAHITNQJYCY-GIZRJKBDSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|