C27H43F4I — CID 90437414
1-cyclohexyl-4-[2-[4-(2,7-difluoro-6-iodohept-1-en-3-yl)cyclohexyl]ethyl]-2,3-difluorocyclohexane (PubChem CID 90437414) has the molecular formula C27H43F4I and a molecular weight of 570.54 g/mol. Its IUPAC name is 1-cyclohexyl-4-[2-[4-(2,7-difluoro-6-iodohept-1-en-3-yl)cyclohexyl]ethyl]-2,3-difluorocyclohexane.
| Compound Name | 1-cyclohexyl-4-[2-[4-(2,7-difluoro-6-iodohept-1-en-3-yl)cyclohexyl]ethyl]-2,3-difluorocyclohexane |
|---|---|
| PubChem CID | 90437414 |
| Molecular Formula | C27H43F4I |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 1-cyclohexyl-4-[2-[4-(2,7-difluoro-6-iodohept-1-en-3-yl)cyclohexyl]ethyl]-2,3-difluorocyclohexane |
| SMILES | C=C(F)C(CCC(I)CF)C1CCC(CCC2CCC(C3CCCCC3)C(F)C2F)CC1 |
| InChI | InChI=1S/C27H43F4I/c1-18(29)24(16-14-23(32)17-28)21-10-7-19(8-11-21)9-12-22-13-15-25(27(31)26(22)30)20-5-3-2-4-6-20/h19-27H,1-17H2 |
| InChIKey | FEROCJGOEFOQKG-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|