C30H51F3O2 — CID 90437547
1-(4-butoxycyclohexyl)-2,3-difluoro-4-[[4-[(1S)-2-fluoro-4-methylcyclohexyl]cyclohexyl]methoxy]cyclohexane (PubChem CID 90437547) has the molecular formula C30H51F3O2 and a molecular weight of 500.73 g/mol. Its IUPAC name is 1-(4-butoxycyclohexyl)-2,3-difluoro-4-[[4-[(1S)-2-fluoro-4-methylcyclohexyl]cyclohexyl]methoxy]cyclohexane.
| Compound Name | 1-(4-butoxycyclohexyl)-2,3-difluoro-4-[[4-[(1S)-2-fluoro-4-methylcyclohexyl]cyclohexyl]methoxy]cyclohexane |
|---|---|
| PubChem CID | 90437547 |
| Molecular Formula | C30H51F3O2 |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.38 |
| IUPAC Name | 1-(4-butoxycyclohexyl)-2,3-difluoro-4-[[4-[(1S)-2-fluoro-4-methylcyclohexyl]cyclohexyl]methoxy]cyclohexane |
| SMILES | CCCCOC1CCC(C2CCC(OCC3CCC([C@@H]4CCC(C)CC4F)CC3)C(F)C2F)CC1 |
| InChI | InChI=1S/C30H51F3O2/c1-3-4-17-34-24-12-10-23(11-13-24)26-15-16-28(30(33)29(26)32)35-19-21-6-8-22(9-7-21)25-14-5-20(2)18-27(25)31/h20-30H,3-19H2,1-2H3/t20?,21?,22?,23?,24?,25-,26?,27?,28?,29?,30?/m0/s1 |
| InChIKey | WNQHAKALGIACTN-CTSHQTRLSA-N |
| XLogP | 8.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|