C21H37F3O2 — CID 118181708
1-butoxy-2,3-difluoro-4-(2-fluoro-4-pentoxycyclohexyl)cyclohexane (PubChem CID 118181708) has the molecular formula C21H37F3O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-butoxy-2,3-difluoro-4-(2-fluoro-4-pentoxycyclohexyl)cyclohexane.
| Compound Name | 1-butoxy-2,3-difluoro-4-(2-fluoro-4-pentoxycyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 118181708 |
| Molecular Formula | C21H37F3O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 1-butoxy-2,3-difluoro-4-(2-fluoro-4-pentoxycyclohexyl)cyclohexane |
| SMILES | CCCCCOC1CCC(C2CCC(OCCCC)C(F)C2F)C(F)C1 |
| InChI | InChI=1S/C21H37F3O2/c1-3-5-7-13-25-15-8-9-16(18(22)14-15)17-10-11-19(21(24)20(17)23)26-12-6-4-2/h15-21H,3-14H2,1-2H3 |
| InChIKey | USYWNWRINQCMLS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|