C18H29F3O2 — CID 138631321
1-(4-but-2-enoxy-2-fluorocyclohexyl)-4-ethoxy-2,3-difluorocyclohexane (PubChem CID 138631321) has the molecular formula C18H29F3O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-(4-but-2-enoxy-2-fluorocyclohexyl)-4-ethoxy-2,3-difluorocyclohexane.
| Compound Name | 1-(4-but-2-enoxy-2-fluorocyclohexyl)-4-ethoxy-2,3-difluorocyclohexane |
|---|---|
| PubChem CID | 138631321 |
| Molecular Formula | C18H29F3O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 1-(4-but-2-enoxy-2-fluorocyclohexyl)-4-ethoxy-2,3-difluorocyclohexane |
| SMILES | CC=CCOC1CCC(C2CCC(OCC)C(F)C2F)C(F)C1 |
| InChI | InChI=1S/C18H29F3O2/c1-3-5-10-23-12-6-7-13(15(19)11-12)14-8-9-16(22-4-2)18(21)17(14)20/h3,5,12-18H,4,6-11H2,1-2H3 |
| InChIKey | PRYTVAMZDUQTFX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|