About 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane
1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane (PubChem CID 118592236) has the molecular formula C21H35F3O
and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane.
Molecular Properties
| Compound Name | 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane |
| PubChem CID | 118592236 |
| Molecular Formula | C21H35F3O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane |
| SMILES | CCOC1CCC(C2CCC(C3CCC(C)CC3)C(F)C2)C(F)C1F |
| InChI | InChI=1S/C21H35F3O/c1-3-25-19-11-10-17(20(23)21(19)24)15-8-9-16(18(22)12-15)14-6-4-13(2)5-7-14/h13-21H,3-12H2,1-2H3 |
| InChIKey | XGBVEHBTXBXQPS-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane?
The IUPAC name of 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane (CID 118592236) is 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane.
What is the SMILES notation for 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane?
The canonical SMILES for 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane is CCOC1CCC(C2CCC(C3CCC(C)CC3)C(F)C2)C(F)C1F.
What is the InChIKey of 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane?
The InChIKey is XGBVEHBTXBXQPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35F3O/c1-3-25-19-11-10-17(20(23)21(19)24)15-8-9-16(18(22)12-15)14-6-4-13(2)5-7-14/h13-21H,3-12H2,1-2H3.
What are the key properties of 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane?
1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane has a molecular weight of 360.50 g/mol, XLogP of 6.06, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-2,3-difluoro-4-[3-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cyclohexane is sourced from PubChem (CID 118592236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).