C21H45FO3 — CID 158971717
2-fluoro-1,4-bis(4-methylcyclohexyl)cyclohexane;methane;trihydrate (PubChem CID 158971717) has the molecular formula C21H45FO3 and a molecular weight of 364.59 g/mol. Its IUPAC name is 2-fluoro-1,4-bis(4-methylcyclohexyl)cyclohexane;methane;trihydrate.
| Compound Name | 2-fluoro-1,4-bis(4-methylcyclohexyl)cyclohexane;methane;trihydrate |
|---|---|
| PubChem CID | 158971717 |
| Molecular Formula | C21H45FO3 |
| Molecular Weight | 364.59 g/mol |
| Exact Mass | 364.34 |
| IUPAC Name | 2-fluoro-1,4-bis(4-methylcyclohexyl)cyclohexane;methane;trihydrate |
| SMILES | C.CC1CCC(C2CCC(C3CCC(C)CC3)C(F)C2)CC1.O.O.O |
| InChI | InChI=1S/C20H35F.CH4.3H2O/c1-14-3-7-16(8-4-14)18-11-12-19(20(21)13-18)17-9-5-15(2)6-10-17;;;;/h14-20H,3-13H2,1-2H3;1H4;3*1H2 |
| InChIKey | HTMWKPKZCJHZRH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |