C25H40F3I — CID 118887189
1,3-difluoro-5-[2-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexyl]-2-iodocyclohexane (PubChem CID 118887189) has the molecular formula C25H40F3I and a molecular weight of 524.49 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexyl]-2-iodocyclohexane.
| Compound Name | 1,3-difluoro-5-[2-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexyl]-2-iodocyclohexane |
|---|---|
| PubChem CID | 118887189 |
| Molecular Formula | C25H40F3I |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 1,3-difluoro-5-[2-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexyl]-2-iodocyclohexane |
| SMILES | CC1CCC(C2CCC(C3CCC(C4CC(F)C(I)C(F)C4)C(F)C3)CC2)CC1 |
| InChI | InChI=1S/C25H40F3I/c1-15-2-4-16(5-3-15)17-6-8-18(9-7-17)19-10-11-21(22(26)12-19)20-13-23(27)25(29)24(28)14-20/h15-25H,2-14H2,1H3 |
| InChIKey | XQBLUDJEPSIVTK-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|