C20H34F3P — CID 142988213
[2,3-difluoro-6-[2-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cycloheptyl]phosphane (PubChem CID 142988213) has the molecular formula C20H34F3P and a molecular weight of 362.46 g/mol. Its IUPAC name is [2,3-difluoro-6-[2-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cycloheptyl]phosphane.
| Compound Name | [2,3-difluoro-6-[2-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cycloheptyl]phosphane |
|---|---|
| PubChem CID | 142988213 |
| Molecular Formula | C20H34F3P |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | [2,3-difluoro-6-[2-fluoro-4-(4-methylcyclohexyl)cyclohexyl]cycloheptyl]phosphane |
| SMILES | CC1CCC(C2CCC(C3CCC(F)C(F)C(P)C3)C(F)C2)CC1 |
| InChI | InChI=1S/C20H34F3P/c1-12-2-4-13(5-3-12)14-6-8-16(18(22)10-14)15-7-9-17(21)20(23)19(24)11-15/h12-20H,2-11,24H2,1H3 |
| InChIKey | PXYHNPCNOQXZHX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|