C25H43F2P — CID 143002994
[2,3-difluoro-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexyl]cyclohexyl]phosphane (PubChem CID 143002994) has the molecular formula C25H43F2P and a molecular weight of 412.59 g/mol. Its IUPAC name is [2,3-difluoro-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexyl]cyclohexyl]phosphane.
| Compound Name | [2,3-difluoro-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexyl]cyclohexyl]phosphane |
|---|---|
| PubChem CID | 143002994 |
| Molecular Formula | C25H43F2P |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | [2,3-difluoro-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexyl]cyclohexyl]phosphane |
| SMILES | CC1CCC(C2CCC(C3CCC(C4CC(F)C(F)C(P)C4)CC3)CC2)CC1 |
| InChI | InChI=1S/C25H43F2P/c1-16-2-4-17(5-3-16)18-6-8-19(9-7-18)20-10-12-21(13-11-20)22-14-23(26)25(27)24(28)15-22/h16-25H,2-15,28H2,1H3 |
| InChIKey | REWZXTAFUHKEMA-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|