C20H36FP — CID 143940053
[2-fluoro-6-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexyl]phosphane (PubChem CID 143940053) has the molecular formula C20H36FP and a molecular weight of 326.48 g/mol. Its IUPAC name is [2-fluoro-6-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexyl]phosphane.
| Compound Name | [2-fluoro-6-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexyl]phosphane |
|---|---|
| PubChem CID | 143940053 |
| Molecular Formula | C20H36FP |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | [2-fluoro-6-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohexyl]phosphane |
| SMILES | CC1CCC(C2CCC(C3CC(C)C(P)C(F)C3)CC2)CC1 |
| InChI | InChI=1S/C20H36FP/c1-13-3-5-15(6-4-13)16-7-9-17(10-8-16)18-11-14(2)20(22)19(21)12-18/h13-20H,3-12,22H2,1-2H3 |
| InChIKey | FQYYLMNICPWCCH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|