C17H24FN — CID 59079145
3-[2-fluoro-6-methyl-4-(4-methylcyclohexyl)cyclohexyl]prop-2-ynenitrile (PubChem CID 59079145) has the molecular formula C17H24FN and a molecular weight of 261.38 g/mol. Its IUPAC name is 3-[2-fluoro-6-methyl-4-(4-methylcyclohexyl)cyclohexyl]prop-2-ynenitrile.
| Compound Name | 3-[2-fluoro-6-methyl-4-(4-methylcyclohexyl)cyclohexyl]prop-2-ynenitrile |
|---|---|
| PubChem CID | 59079145 |
| Molecular Formula | C17H24FN |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | 3-[2-fluoro-6-methyl-4-(4-methylcyclohexyl)cyclohexyl]prop-2-ynenitrile |
| SMILES | CC1CCC(C2CC(C)C(C#CC#N)C(F)C2)CC1 |
| InChI | InChI=1S/C17H24FN/c1-12-5-7-14(8-6-12)15-10-13(2)16(4-3-9-19)17(18)11-15/h12-17H,5-8,10-11H2,1-2H3 |
| InChIKey | YUAUBPKOZGFQMI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|