C12H18F4 — CID 89198348
1,2,3-trifluoro-5-(4-fluorocyclohexyl)cyclohexane (PubChem CID 89198348) has the molecular formula C12H18F4 and a molecular weight of 238.27 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-(4-fluorocyclohexyl)cyclohexane.
| Compound Name | 1,2,3-trifluoro-5-(4-fluorocyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 89198348 |
| Molecular Formula | C12H18F4 |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1,2,3-trifluoro-5-(4-fluorocyclohexyl)cyclohexane |
| SMILES | FC1CCC(C2CC(F)C(F)C(F)C2)CC1 |
| InChI | InChI=1S/C12H18F4/c13-9-3-1-7(2-4-9)8-5-10(14)12(16)11(15)6-8/h7-12H,1-6H2 |
| InChIKey | IKZJPQOCWMPLGQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |