About 4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane
4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane (PubChem CID 175202210) has the molecular formula C10H14F4
and a molecular weight of 210.21 g/mol. Its IUPAC name is 4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane.
Analyze 4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane?
The IUPAC name of 4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane (CID 175202210) is 4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane.
What is the SMILES notation for 4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane?
The canonical SMILES for 4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane is FC1CCC(C2CC(F)C2F)CC1F.
What is the InChIKey of 4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane?
The InChIKey is MLWYGDBLLUQQDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F4/c11-7-2-1-5(3-8(7)12)6-4-9(13)10(6)14/h5-10H,1-4H2.
What are the key properties of 4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane?
4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane has a molecular weight of 210.21 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-difluorocyclobutyl)-1,2-difluorocyclohexane is sourced from PubChem (CID 175202210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).