C12H18F4O — CID 23534734
3-fluoro-4-(3,4,5-trifluorocyclohexyl)cyclohexan-1-ol (PubChem CID 23534734) has the molecular formula C12H18F4O and a molecular weight of 254.27 g/mol. Its IUPAC name is 3-fluoro-4-(3,4,5-trifluorocyclohexyl)cyclohexan-1-ol.
| Compound Name | 3-fluoro-4-(3,4,5-trifluorocyclohexyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 23534734 |
| Molecular Formula | C12H18F4O |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-fluoro-4-(3,4,5-trifluorocyclohexyl)cyclohexan-1-ol |
| SMILES | OC1CCC(C2CC(F)C(F)C(F)C2)C(F)C1 |
| InChI | InChI=1S/C12H18F4O/c13-9-5-7(17)1-2-8(9)6-3-10(14)12(16)11(15)4-6/h6-12,17H,1-5H2 |
| InChIKey | XFPQBXOBEJIDBA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |