C18H21F15 — CID 89407524
1,2,3,4,5,6,7,8,9,10,11,12,13,14,16-pentadecafluorocyclooctadecane (PubChem CID 89407524) has the molecular formula C18H21F15 and a molecular weight of 522.34 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,10,11,12,13,14,16-pentadecafluorocyclooctadecane.
| Compound Name | 1,2,3,4,5,6,7,8,9,10,11,12,13,14,16-pentadecafluorocyclooctadecane |
|---|---|
| PubChem CID | 89407524 |
| Molecular Formula | C18H21F15 |
| Molecular Weight | 522.34 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,10,11,12,13,14,16-pentadecafluorocyclooctadecane |
| SMILES | FC1CCC(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C1 |
| InChI | InChI=1S/C18H21F15/c19-4-1-2-5(20)7(22)9(24)11(26)13(28)15(30)17(32)18(33)16(31)14(29)12(27)10(25)8(23)6(21)3-4/h4-18H,1-3H2 |
| InChIKey | HUZKGYVFQVBPFB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.34 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |