About [(1S,2S)-2,4-difluorocyclohexyl]methanamine
[(1S,2S)-2,4-difluorocyclohexyl]methanamine (PubChem CID 122578445) has the molecular formula C7H13F2N
and a molecular weight of 149.18 g/mol. Its IUPAC name is [(1S,2S)-2,4-difluorocyclohexyl]methanamine.
Molecular Properties
| Compound Name | [(1S,2S)-2,4-difluorocyclohexyl]methanamine |
| PubChem CID | 122578445 |
| Molecular Formula | C7H13F2N |
| Molecular Weight | 149.18 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | [(1S,2S)-2,4-difluorocyclohexyl]methanamine |
| SMILES | NC[C@@H]1CCC(F)C[C@@H]1F |
| InChI | InChI=1S/C7H13F2N/c8-6-2-1-5(4-10)7(9)3-6/h5-7H,1-4,10H2/t5-,6?,7-/m0/s1 |
| InChIKey | KYCNGDZMJXQQRQ-LOJRBXKRSA-N |
| XLogP | 1.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1S,2S)-2,4-difluorocyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2,4-difluorocyclohexyl]methanamine?
The IUPAC name of [(1S,2S)-2,4-difluorocyclohexyl]methanamine (CID 122578445) is [(1S,2S)-2,4-difluorocyclohexyl]methanamine.
What is the SMILES notation for [(1S,2S)-2,4-difluorocyclohexyl]methanamine?
The canonical SMILES for [(1S,2S)-2,4-difluorocyclohexyl]methanamine is NC[C@@H]1CCC(F)C[C@@H]1F.
What is the InChIKey of [(1S,2S)-2,4-difluorocyclohexyl]methanamine?
The InChIKey is KYCNGDZMJXQQRQ-LOJRBXKRSA-N. The full InChI is InChI=1S/C7H13F2N/c8-6-2-1-5(4-10)7(9)3-6/h5-7H,1-4,10H2/t5-,6?,7-/m0/s1.
What are the key properties of [(1S,2S)-2,4-difluorocyclohexyl]methanamine?
[(1S,2S)-2,4-difluorocyclohexyl]methanamine has a molecular weight of 149.18 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2,4-difluorocyclohexyl]methanamine is sourced from PubChem (CID 122578445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).