methyl 2,3-difluorocyclopentane-1-carboxylate

C7H10F2O2 — CID 19077661

IUPACmethyl 2,3-difluorocyclopentane-1-carboxylate
SMILESCOC(=O)C1CCC(F)C1F
InChIInChI=1S/C7H10F2O2/c1-11-7(10)4-2-3-5(8)6(4)9/h4-6H,2-3H2,1H3
InChIKeyZSVMAAXSYXVFSS-UHFFFAOYSA-N
MW164.15 g/mol
LogP1.25
Rot. Bonds1

About methyl 2,3-difluorocyclopentane-1-carboxylate

methyl 2,3-difluorocyclopentane-1-carboxylate (PubChem CID 19077661) has the molecular formula C7H10F2O2 and a molecular weight of 164.15 g/mol. Its IUPAC name is methyl 2,3-difluorocyclopentane-1-carboxylate.

Molecular Properties

Compound Namemethyl 2,3-difluorocyclopentane-1-carboxylate
PubChem CID19077661
Molecular FormulaC7H10F2O2
Molecular Weight164.15 g/mol
Exact Mass164.06
IUPAC Namemethyl 2,3-difluorocyclopentane-1-carboxylate
SMILESCOC(=O)C1CCC(F)C1F
InChIInChI=1S/C7H10F2O2/c1-11-7(10)4-2-3-5(8)6(4)9/h4-6H,2-3H2,1H3
InChIKeyZSVMAAXSYXVFSS-UHFFFAOYSA-N
XLogP1.25
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.15
LogP ≤ 51.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 2,3-difluorocyclopentane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

methyl 2,3-difluorocyclobutane-1-carboxylate
CID 175603308
tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate
CID 19077660
tetramethyl (1S,2R,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylate
CID 102016488
dimethyl cyclopropane-1,2-dicarboxylate
CID 2724542
methyl 2-carbonochloridoylcyclobutane-1-carboxylate
CID 12809237
cis-methyl (1R,2R)-2-(fluoromethyl)cyclopropane-1-carboxylate
CID 122227702
3,4-bis(methoxycarbonyl)cyclohexane-1-carboxylic acid
CID 66983998
trans-methyl (1S,3S)-3-fluorocyclopentane-1-carboxylate
CID 129418708
dimethyl (1R,2S,5S)-bicyclo[2.2.1]heptane-2,5-dicarboxylate
CID 174166263
methyl 4-fluorocyclohexane-1-carboxylate
CID 21281592
trimethyl (1R,2R,4R)-cyclohexane-1,2,4-tricarboxylate
CID 12616208
methyl (3S,4R)-3-fluoropiperidine-4-carboxylate
CID 97289441

Frequently Asked Questions

What is the IUPAC name of methyl 2,3-difluorocyclopentane-1-carboxylate?
The IUPAC name of methyl 2,3-difluorocyclopentane-1-carboxylate (CID 19077661) is methyl 2,3-difluorocyclopentane-1-carboxylate.
What is the SMILES notation for methyl 2,3-difluorocyclopentane-1-carboxylate?
The canonical SMILES for methyl 2,3-difluorocyclopentane-1-carboxylate is COC(=O)C1CCC(F)C1F.
What is the InChIKey of methyl 2,3-difluorocyclopentane-1-carboxylate?
The InChIKey is ZSVMAAXSYXVFSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2O2/c1-11-7(10)4-2-3-5(8)6(4)9/h4-6H,2-3H2,1H3.
What are the key properties of methyl 2,3-difluorocyclopentane-1-carboxylate?
methyl 2,3-difluorocyclopentane-1-carboxylate has a molecular weight of 164.15 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-difluorocyclopentane-1-carboxylate is sourced from PubChem (CID 19077661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).