About tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate
tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate (PubChem CID 19077660) has the molecular formula C12H21F2NO4
and a molecular weight of 281.30 g/mol. Its IUPAC name is tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate.
Analyze tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate?
The IUPAC name of tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate (CID 19077660) is tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate.
What is the SMILES notation for tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate?
The canonical SMILES for tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate is CC(C)(C)OC(N)=O.COC(=O)C1CCC(F)C1F.
What is the InChIKey of tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate?
The InChIKey is XCVGIEAKFACEGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2O2.C5H11NO2/c1-11-7(10)4-2-3-5(8)6(4)9;1-5(2,3)8-4(6)7/h4-6H,2-3H2,1H3;1-3H3,(H2,6,7).
What are the key properties of tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate?
tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate has a molecular weight of 281.30 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl carbamate;methyl 2,3-difluorocyclopentane-1-carboxylate is sourced from PubChem (CID 19077660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).