About trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate
trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate (PubChem CID 70286212) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate.
Analyze trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate?
The IUPAC name of trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate (CID 70286212) is trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate.
What is the SMILES notation for trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate?
The canonical SMILES for trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate is COC(=O)[C@@H]1CCC[C@H]1C(=O)OC(C)(C)C.
What is the InChIKey of trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate?
The InChIKey is BUVBGCFNDBSTOH-RKDXNWHRSA-N. The full InChI is InChI=1S/C12H20O4/c1-12(2,3)16-11(14)9-7-5-6-8(9)10(13)15-4/h8-9H,5-7H2,1-4H3/t8-,9-/m1/s1.
What are the key properties of trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate?
trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate has a molecular weight of 228.29 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-1-O-tert-butyl 2-O-methyl (1R,2R)-cyclopentane-1,2-dicarboxylate is sourced from PubChem (CID 70286212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).