C11H22N2O2 — CID 151224928
cis-tert-butyl (1R,2S)-2-hydrazinylcyclohexane-1-carboxylate (PubChem CID 151224928) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is cis-tert-butyl (1R,2S)-2-hydrazinylcyclohexane-1-carboxylate.
| Compound Name | cis-tert-butyl (1R,2S)-2-hydrazinylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 151224928 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | cis-tert-butyl (1R,2S)-2-hydrazinylcyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCC[C@@H]1NN |
| InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)8-6-4-5-7-9(8)13-12/h8-9,13H,4-7,12H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | NNBLAXNASPNBCZ-BDAKNGLRSA-N |
| XLogP | 1.35 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|