About cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate
cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate (PubChem CID 55285846) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate.
Analyze cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate?
The IUPAC name of cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate (CID 55285846) is cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate.
What is the SMILES notation for cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate?
The canonical SMILES for cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate is COC(=O)[C@H]1CC[C@@H]1CN.
What is the InChIKey of cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate?
The InChIKey is ZUWRDCWIFSQITP-RITPCOANSA-N. The full InChI is InChI=1S/C7H13NO2/c1-10-7(9)6-3-2-5(6)4-8/h5-6H,2-4,8H2,1H3/t5-,6+/m1/s1.
What are the key properties of cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate?
cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate has a molecular weight of 143.19 g/mol, XLogP of 0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1S,2S)-2-(aminomethyl)cyclobutane-1-carboxylate is sourced from PubChem (CID 55285846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).