About trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate
trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate (PubChem CID 84716638) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate.
Analyze trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate?
The IUPAC name of trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate (CID 84716638) is trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate.
What is the SMILES notation for trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate?
The canonical SMILES for trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate is COC(=O)[C@H]1CCC[C@H]1CN.
What is the InChIKey of trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate?
The InChIKey is YIGIXTPUHJVGNC-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H15NO2/c1-11-8(10)7-4-2-3-6(7)5-9/h6-7H,2-5,9H2,1H3/t6-,7-/m0/s1.
What are the key properties of trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate?
trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate has a molecular weight of 157.21 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1S,2R)-2-(aminomethyl)cyclopentane-1-carboxylate is sourced from PubChem (CID 84716638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).