C6H8BrF3 — CID 146282305
(5R)-1-bromo-2,3,5-trifluorocyclohexane (PubChem CID 146282305) has the molecular formula C6H8BrF3 and a molecular weight of 217.03 g/mol. Its IUPAC name is (5R)-1-bromo-2,3,5-trifluorocyclohexane.
| Compound Name | (5R)-1-bromo-2,3,5-trifluorocyclohexane |
|---|---|
| PubChem CID | 146282305 |
| Molecular Formula | C6H8BrF3 |
| Molecular Weight | 217.03 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | (5R)-1-bromo-2,3,5-trifluorocyclohexane |
| SMILES | FC1C[C@@H](F)CC(Br)C1F |
| InChI | InChI=1S/C6H8BrF3/c7-4-1-3(8)2-5(9)6(4)10/h3-6H,1-2H2/t3-,4?,5?,6?/m0/s1 |
| InChIKey | CQARAODQRZWMRC-ALMVMMGASA-N |
| XLogP | 2.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.03 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|