C12H13F3 — CID 98042326
[(1R,2S,3R,5R)-2,3,5-trifluorocyclohexyl]benzene (PubChem CID 98042326) has the molecular formula C12H13F3 and a molecular weight of 214.23 g/mol. Its IUPAC name is [(1R,2S,3R,5R)-2,3,5-trifluorocyclohexyl]benzene.
| Compound Name | [(1R,2S,3R,5R)-2,3,5-trifluorocyclohexyl]benzene |
|---|---|
| PubChem CID | 98042326 |
| Molecular Formula | C12H13F3 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | [(1R,2S,3R,5R)-2,3,5-trifluorocyclohexyl]benzene |
| SMILES | F[C@H]1C[C@@H](F)[C@@H](F)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C12H13F3/c13-9-6-10(12(15)11(14)7-9)8-4-2-1-3-5-8/h1-5,9-12H,6-7H2/t9-,10-,11-,12+/m1/s1 |
| InChIKey | WGKUQXLPNSXGNG-KKOKHZNYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |