C16H16BrN — CID 138039926
(2-bromophenyl)-[(1R,2S)-2-phenylcyclopropyl]methanamine (PubChem CID 138039926) has the molecular formula C16H16BrN and a molecular weight of 302.22 g/mol. Its IUPAC name is (2-bromophenyl)-[(1R,2S)-2-phenylcyclopropyl]methanamine.
| Compound Name | (2-bromophenyl)-[(1R,2S)-2-phenylcyclopropyl]methanamine |
|---|---|
| PubChem CID | 138039926 |
| Molecular Formula | C16H16BrN |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | (2-bromophenyl)-[(1R,2S)-2-phenylcyclopropyl]methanamine |
| SMILES | NC(c1ccccc1Br)[C@@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H16BrN/c17-15-9-5-4-8-12(15)16(18)14-10-13(14)11-6-2-1-3-7-11/h1-9,13-14,16H,10,18H2/t13-,14-,16?/m1/s1 |
| InChIKey | GWYQSCNWPFVNLT-UIDSBSESSA-N |
| XLogP | 4.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |