C16H15Br2N — CID 107946944
(2,4-dibromophenyl)-(2-phenylcyclopropyl)methanamine (PubChem CID 107946944) has the molecular formula C16H15Br2N and a molecular weight of 381.11 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(2-phenylcyclopropyl)methanamine.
| Compound Name | (2,4-dibromophenyl)-(2-phenylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 107946944 |
| Molecular Formula | C16H15Br2N |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | (2,4-dibromophenyl)-(2-phenylcyclopropyl)methanamine |
| SMILES | NC(c1ccc(Br)cc1Br)C1CC1c1ccccc1 |
| InChI | InChI=1S/C16H15Br2N/c17-11-6-7-12(15(18)8-11)16(19)14-9-13(14)10-4-2-1-3-5-10/h1-8,13-14,16H,9,19H2 |
| InChIKey | GIQUMPRKLPUVBD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |