About 1-bromo-2,3-difluorocyclohexane
1-bromo-2,3-difluorocyclohexane (PubChem CID 118181696) has the molecular formula C6H9BrF2
and a molecular weight of 199.04 g/mol. Its IUPAC name is 1-bromo-2,3-difluorocyclohexane.
Molecular Properties
| Compound Name | 1-bromo-2,3-difluorocyclohexane |
| PubChem CID | 118181696 |
| Molecular Formula | C6H9BrF2 |
| Molecular Weight | 199.04 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 1-bromo-2,3-difluorocyclohexane |
| SMILES | FC1CCCC(Br)C1F |
| InChI | InChI=1S/C6H9BrF2/c7-4-2-1-3-5(8)6(4)9/h4-6H,1-3H2 |
| InChIKey | KEQRKFWVHKHMDF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.04 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,3-difluorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,3-difluorocyclohexane?
The IUPAC name of 1-bromo-2,3-difluorocyclohexane (CID 118181696) is 1-bromo-2,3-difluorocyclohexane.
What is the SMILES notation for 1-bromo-2,3-difluorocyclohexane?
The canonical SMILES for 1-bromo-2,3-difluorocyclohexane is FC1CCCC(Br)C1F.
What is the InChIKey of 1-bromo-2,3-difluorocyclohexane?
The InChIKey is KEQRKFWVHKHMDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrF2/c7-4-2-1-3-5(8)6(4)9/h4-6H,1-3H2.
What are the key properties of 1-bromo-2,3-difluorocyclohexane?
1-bromo-2,3-difluorocyclohexane has a molecular weight of 199.04 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,3-difluorocyclohexane is sourced from PubChem (CID 118181696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).