C10H18Br2 — CID 73175476
1,2-dibromocyclodecane (PubChem CID 73175476) has the molecular formula C10H18Br2 and a molecular weight of 298.06 g/mol. Its IUPAC name is 1,2-dibromocyclodecane.
| Compound Name | 1,2-dibromocyclodecane |
|---|---|
| PubChem CID | 73175476 |
| Molecular Formula | C10H18Br2 |
| Molecular Weight | 298.06 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 1,2-dibromocyclodecane |
| SMILES | BrC1CCCCCCCCC1Br |
| InChI | InChI=1S/C10H18Br2/c11-9-7-5-3-1-2-4-6-8-10(9)12/h9-10H,1-8H2 |
| InChIKey | QYZIQNSPCPRPGV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.06 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|