C12H18Br6 — CID 177386229
(1R,2R,5R,6S,10R)-1,2,5,6,9,10-hexabromocyclododecane (PubChem CID 177386229) has the molecular formula C12H18Br6 and a molecular weight of 641.70 g/mol. Its IUPAC name is (1R,2R,5R,6S,10R)-1,2,5,6,9,10-hexabromocyclododecane.
| Compound Name | (1R,2R,5R,6S,10R)-1,2,5,6,9,10-hexabromocyclododecane |
|---|---|
| PubChem CID | 177386229 |
| Molecular Formula | C12H18Br6 |
| Molecular Weight | 641.70 g/mol |
| Exact Mass | 635.65 |
| IUPAC Name | (1R,2R,5R,6S,10R)-1,2,5,6,9,10-hexabromocyclododecane |
| SMILES | BrC1CC[C@H](Br)[C@H](Br)CC[C@@H](Br)[C@H](Br)CC[C@H]1Br |
| InChI | InChI=1S/C12H18Br6/c13-7-1-2-8(14)10(16)5-6-12(18)11(17)4-3-9(7)15/h7-12H,1-6H2/t7-,8-,9-,10+,11-,12?/m1/s1 |
| InChIKey | DEIGXXQKDWULML-CDDAVMOPSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|