C8H12Br2Se — CID 139177147
(1R,2R,5R,6R)-2,6-dibromo-9-selenabicyclo[3.3.1]nonane (PubChem CID 139177147) has the molecular formula C8H12Br2Se and a molecular weight of 346.95 g/mol. Its IUPAC name is (1R,2R,5R,6R)-2,6-dibromo-9-selenabicyclo[3.3.1]nonane.
| Compound Name | (1R,2R,5R,6R)-2,6-dibromo-9-selenabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 139177147 |
| Molecular Formula | C8H12Br2Se |
| Molecular Weight | 346.95 g/mol |
| Exact Mass | 345.85 |
| IUPAC Name | (1R,2R,5R,6R)-2,6-dibromo-9-selenabicyclo[3.3.1]nonane |
| SMILES | Br[C@@H]1CC[C@H]2[Se][C@@H]1CC[C@H]2Br |
| InChI | InChI=1S/C8H12Br2Se/c9-5-1-3-7-6(10)2-4-8(5)11-7/h5-8H,1-4H2/t5-,6-,7-,8-/m1/s1 |
| InChIKey | ZFIWOILTHHAJLQ-WCTZXXKLSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.95 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|