C12H21AlBr6 — CID 174675099
alumane;1,2,3,4,5,6-hexabromocyclododecane (PubChem CID 174675099) has the molecular formula C12H21AlBr6 and a molecular weight of 671.71 g/mol. Its IUPAC name is alumane;1,2,3,4,5,6-hexabromocyclododecane.
| Compound Name | alumane;1,2,3,4,5,6-hexabromocyclododecane |
|---|---|
| PubChem CID | 174675099 |
| Molecular Formula | C12H21AlBr6 |
| Molecular Weight | 671.71 g/mol |
| Exact Mass | 665.66 |
| IUPAC Name | alumane;1,2,3,4,5,6-hexabromocyclododecane |
| SMILES | BrC1CCCCCCC(Br)C(Br)C(Br)C(Br)C1Br.[AlH3] |
| InChI | InChI=1S/C12H18Br6.Al.3H/c13-7-5-3-1-2-4-6-8(14)10(16)12(18)11(17)9(7)15;;;;/h7-12H,1-6H2;;;; |
| InChIKey | BMKYYEQIVPHPKK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.71 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|