C6H12BrN — CID 92968948
cis-(1S,2R)-2-bromocyclohexan-1-amine (PubChem CID 92968948) has the molecular formula C6H12BrN and a molecular weight of 178.07 g/mol. Its IUPAC name is cis-(1S,2R)-2-bromocyclohexan-1-amine.
| Compound Name | cis-(1S,2R)-2-bromocyclohexan-1-amine |
|---|---|
| PubChem CID | 92968948 |
| Molecular Formula | C6H12BrN |
| Molecular Weight | 178.07 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | cis-(1S,2R)-2-bromocyclohexan-1-amine |
| SMILES | N[C@H]1CCCC[C@H]1Br |
| InChI | InChI=1S/C6H12BrN/c7-5-3-1-2-4-6(5)8/h5-6H,1-4,8H2/t5-,6+/m1/s1 |
| InChIKey | AQBYKNASJVORLT-RITPCOANSA-N |
| XLogP | 1.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.07 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|