C11H24N2 — CID 139815756
trans-(1S,2S)-cycloundecane-1,2-diamine (PubChem CID 139815756) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is trans-(1S,2S)-cycloundecane-1,2-diamine.
| Compound Name | trans-(1S,2S)-cycloundecane-1,2-diamine |
|---|---|
| PubChem CID | 139815756 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | trans-(1S,2S)-cycloundecane-1,2-diamine |
| SMILES | N[C@H]1CCCCCCCCC[C@@H]1N |
| InChI | InChI=1S/C11H24N2/c12-10-8-6-4-2-1-3-5-7-9-11(10)13/h10-11H,1-9,12-13H2/t10-,11-/m0/s1 |
| InChIKey | QMMLYSYSLFEGJU-QWRGUYRKSA-N |
| XLogP | 2.17 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |