C10H22N2O4 — CID 159991522
acetic acid;trans-(1R,2R)-cyclohexane-1,2-diamine (PubChem CID 159991522) has the molecular formula C10H22N2O4 and a molecular weight of 234.30 g/mol. Its IUPAC name is acetic acid;trans-(1R,2R)-cyclohexane-1,2-diamine.
| Compound Name | acetic acid;trans-(1R,2R)-cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 159991522 |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | acetic acid;trans-(1R,2R)-cyclohexane-1,2-diamine |
| SMILES | CC(=O)O.CC(=O)O.N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C6H14N2.2C2H4O2/c7-5-3-1-2-4-6(5)8;2*1-2(3)4/h5-6H,1-4,7-8H2;2*1H3,(H,3,4)/t5-,6-;;/m1../s1 |
| InChIKey | OGZVEPYZKPDQBT-BNTLRKBRSA-N |
| XLogP | 0.40 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |