C6H17N2O4P — CID 70269724
cyclohexane-1,2-diamine;phosphoric acid (PubChem CID 70269724) has the molecular formula C6H17N2O4P and a molecular weight of 212.19 g/mol. Its IUPAC name is cyclohexane-1,2-diamine;phosphoric acid.
| Compound Name | cyclohexane-1,2-diamine;phosphoric acid |
|---|---|
| PubChem CID | 70269724 |
| Molecular Formula | C6H17N2O4P |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | cyclohexane-1,2-diamine;phosphoric acid |
| SMILES | NC1CCCCC1N.O=P(O)(O)O |
| InChI | InChI=1S/C6H14N2.H3O4P/c7-5-3-1-2-4-6(5)8;1-5(2,3)4/h5-6H,1-4,7-8H2;(H3,1,2,3,4) |
| InChIKey | ACXPBBUQOGOJEJ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|