C6H15N2O4PPt — CID 3049901
cyclohexane-1,2-diamine;hydron;platinum(2+);phosphate (PubChem CID 3049901) has the molecular formula C6H15N2O4PPt and a molecular weight of 405.25 g/mol. Its IUPAC name is cyclohexane-1,2-diamine;hydron;platinum(2+);phosphate.
| Compound Name | cyclohexane-1,2-diamine;hydron;platinum(2+);phosphate |
|---|---|
| PubChem CID | 3049901 |
| Molecular Formula | C6H15N2O4PPt |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | cyclohexane-1,2-diamine;hydron;platinum(2+);phosphate |
| SMILES | NC1CCCCC1N.O=P([O-])([O-])[O-].[H+].[Pt+2] |
| InChI | InChI=1S/C6H14N2.H3O4P.Pt/c7-5-3-1-2-4-6(5)8;1-5(2,3)4;/h5-6H,1-4,7-8H2;(H3,1,2,3,4);/q;;+2/p-2 |
| InChIKey | LVCMCNWJPZSGKW-UHFFFAOYSA-L |
| XLogP | -2.50 |
| TPSA | 138.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|