C6H20N2O2Pt+4 — CID 59971329
dioxidanium;platinum(2+);trans-(1R,2R)-cyclohexane-1,2-diamine (PubChem CID 59971329) has the molecular formula C6H20N2O2Pt+4 and a molecular weight of 347.32 g/mol. Its IUPAC name is dioxidanium;platinum(2+);trans-(1R,2R)-cyclohexane-1,2-diamine.
| Compound Name | dioxidanium;platinum(2+);trans-(1R,2R)-cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 59971329 |
| Molecular Formula | C6H20N2O2Pt+4 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | dioxidanium;platinum(2+);trans-(1R,2R)-cyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCC[C@H]1N.[OH3+].[OH3+].[Pt+2] |
| InChI | InChI=1S/C6H14N2.2H2O.Pt/c7-5-3-1-2-4-6(5)8;;;/h5-6H,1-4,7-8H2;2*1H2;/q;;;+2/p+2/t5-,6-;;;/m1.../s1 |
| InChIKey | FWZZTLRIXBYOKR-SKSSAGQDSA-P |
| XLogP | -1.63 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|