C5H14Cl2N2 — CID 66730598
cis-(1R,2S)-cyclopentane-1,2-diamine;dihydrochloride (PubChem CID 66730598) has the molecular formula C5H14Cl2N2 and a molecular weight of 173.09 g/mol. Its IUPAC name is cis-(1R,2S)-cyclopentane-1,2-diamine;dihydrochloride.
| Compound Name | cis-(1R,2S)-cyclopentane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 66730598 |
| Molecular Formula | C5H14Cl2N2 |
| Molecular Weight | 173.09 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | cis-(1R,2S)-cyclopentane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H]1CCC[C@@H]1N |
| InChI | InChI=1S/C5H12N2.2ClH/c6-4-2-1-3-5(4)7;;/h4-5H,1-3,6-7H2;2*1H/t4-,5+;; |
| InChIKey | VZCLGIZICFQJBX-QGAATHCOSA-N |
| XLogP | 0.67 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.09 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |