C5H10IN — CID 90228959
cis-(1S,2R)-2-iodocyclopentan-1-amine (PubChem CID 90228959) has the molecular formula C5H10IN and a molecular weight of 211.05 g/mol. Its IUPAC name is cis-(1S,2R)-2-iodocyclopentan-1-amine.
| Compound Name | cis-(1S,2R)-2-iodocyclopentan-1-amine |
|---|---|
| PubChem CID | 90228959 |
| Molecular Formula | C5H10IN |
| Molecular Weight | 211.05 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | cis-(1S,2R)-2-iodocyclopentan-1-amine |
| SMILES | N[C@H]1CCC[C@H]1I |
| InChI | InChI=1S/C5H10IN/c6-4-2-1-3-5(4)7/h4-5H,1-3,7H2/t4-,5+/m1/s1 |
| InChIKey | KUBRURAJGSXLMM-UHNVWZDZSA-N |
| XLogP | 1.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.05 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|