C8H16N2O4Pt+2 — CID 6394767
cyclohexane-1,2-diamine;oxalic acid;platinum(2+) (PubChem CID 6394767) has the molecular formula C8H16N2O4Pt+2 and a molecular weight of 399.30 g/mol. Its IUPAC name is cyclohexane-1,2-diamine;oxalic acid;platinum(2+).
| Compound Name | cyclohexane-1,2-diamine;oxalic acid;platinum(2+) |
|---|---|
| PubChem CID | 6394767 |
| Molecular Formula | C8H16N2O4Pt+2 |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | cyclohexane-1,2-diamine;oxalic acid;platinum(2+) |
| SMILES | NC1CCCCC1N.O=C(O)C(=O)O.[Pt+2] |
| InChI | InChI=1S/C6H14N2.C2H2O4.Pt/c7-5-3-1-2-4-6(5)8;3-1(4)2(5)6;/h5-6H,1-4,7-8H2;(H,3,4)(H,5,6);/q;;+2 |
| InChIKey | ZROHGHOFXNOHSO-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|