About 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine
2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine (PubChem CID 88686306) has the molecular formula C8H18N2O3Pt
and a molecular weight of 385.32 g/mol. Its IUPAC name is 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine.
Molecular Properties
| Compound Name | 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine |
| PubChem CID | 88686306 |
| Molecular Formula | C8H18N2O3Pt |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCC[C@H]1N.O=C(O)CO.[Pt] |
| InChI | InChI=1S/C6H14N2.C2H4O3.Pt/c7-5-3-1-2-4-6(5)8;3-1-2(4)5;/h5-6H,1-4,7-8H2;3H,1H2,(H,4,5);/t5-,6-;;/m1../s1 |
| InChIKey | WHEPBYSFPIQKMR-BNTLRKBRSA-N |
| XLogP | -0.72 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine?
The IUPAC name of 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine (CID 88686306) is 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine.
What is the SMILES notation for 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine?
The canonical SMILES for 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine is N[C@@H]1CCCC[C@H]1N.O=C(O)CO.[Pt].
What is the InChIKey of 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine?
The InChIKey is WHEPBYSFPIQKMR-BNTLRKBRSA-N. The full InChI is InChI=1S/C6H14N2.C2H4O3.Pt/c7-5-3-1-2-4-6(5)8;3-1-2(4)5;/h5-6H,1-4,7-8H2;3H,1H2,(H,4,5);/t5-,6-;;/m1../s1.
What are the key properties of 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine?
2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine has a molecular weight of 385.32 g/mol, XLogP of -0.72, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyacetic acid;platinum;trans-(1R,2R)-cyclohexane-1,2-diamine is sourced from PubChem (CID 88686306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).