C16H34N2O10 — CID 67321744
acetic acid;cyclohexane-1,2-diamine (PubChem CID 67321744) has the molecular formula C16H34N2O10 and a molecular weight of 414.45 g/mol. Its IUPAC name is acetic acid;cyclohexane-1,2-diamine.
| Compound Name | acetic acid;cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 67321744 |
| Molecular Formula | C16H34N2O10 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | acetic acid;cyclohexane-1,2-diamine |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.NC1CCCCC1N |
| InChI | InChI=1S/C6H14N2.5C2H4O2/c7-5-3-1-2-4-6(5)8;5*1-2(3)4/h5-6H,1-4,7-8H2;5*1H3,(H,3,4) |
| InChIKey | DIZLMRQFIGWEGF-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 238.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |