C9H24N4 — CID 162135343
cyclohexane-1,2-diamine;propane-1,3-diamine (PubChem CID 162135343) has the molecular formula C9H24N4 and a molecular weight of 188.32 g/mol. Its IUPAC name is cyclohexane-1,2-diamine;propane-1,3-diamine.
| Compound Name | cyclohexane-1,2-diamine;propane-1,3-diamine |
|---|---|
| PubChem CID | 162135343 |
| Molecular Formula | C9H24N4 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.20 |
| IUPAC Name | cyclohexane-1,2-diamine;propane-1,3-diamine |
| SMILES | NC1CCCCC1N.NCCCN |
| InChI | InChI=1S/C6H14N2.C3H10N2/c7-5-3-1-2-4-6(5)8;4-2-1-3-5/h5-6H,1-4,7-8H2;1-5H2 |
| InChIKey | ZJEWWCLXJAPEFO-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |