About trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride
trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride (PubChem CID 163198683) has the molecular formula C7H18Cl2N2
and a molecular weight of 201.14 g/mol. Its IUPAC name is trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride |
| PubChem CID | 163198683 |
| Molecular Formula | C7H18Cl2N2 |
| Molecular Weight | 201.14 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.NC[C@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C7H16N2.2ClH/c8-5-6-3-1-2-4-7(6)9;;/h6-7H,1-5,8-9H2;2*1H/t6-,7-;;/m1../s1 |
| InChIKey | JMZYSMFVIDNXBL-GPJOBVNKSA-N |
| XLogP | 1.31 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.14 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride?
The IUPAC name of trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride (CID 163198683) is trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride.
What is the SMILES notation for trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride?
The canonical SMILES for trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride is Cl.Cl.NC[C@H]1CCCC[C@H]1N.
What is the InChIKey of trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride?
The InChIKey is JMZYSMFVIDNXBL-GPJOBVNKSA-N. The full InChI is InChI=1S/C7H16N2.2ClH/c8-5-6-3-1-2-4-7(6)9;;/h6-7H,1-5,8-9H2;2*1H/t6-,7-;;/m1../s1.
What are the key properties of trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride?
trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride has a molecular weight of 201.14 g/mol, XLogP of 1.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(aminomethyl)cyclohexan-1-amine;dihydrochloride is sourced from PubChem (CID 163198683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).