C18H30Br6 — CID 101354867
1,2,5,6,9,10-hexabromocyclooctadecane (PubChem CID 101354867) has the molecular formula C18H30Br6 and a molecular weight of 725.86 g/mol. Its IUPAC name is 1,2,5,6,9,10-hexabromocyclooctadecane.
| Compound Name | 1,2,5,6,9,10-hexabromocyclooctadecane |
|---|---|
| PubChem CID | 101354867 |
| Molecular Formula | C18H30Br6 |
| Molecular Weight | 725.86 g/mol |
| Exact Mass | 719.74 |
| IUPAC Name | 1,2,5,6,9,10-hexabromocyclooctadecane |
| SMILES | BrC1CCCCCCCCC(Br)C(Br)CCC(Br)C(Br)CCC1Br |
| InChI | InChI=1S/C18H30Br6/c19-13-7-5-3-1-2-4-6-8-14(20)16(22)10-12-18(24)17(23)11-9-15(13)21/h13-18H,1-12H2 |
| InChIKey | XFKCADNTEHYIAU-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.86 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|